C20H13N3O2 — CID 139589937
19-hydroxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one (PubChem CID 139589937) has the molecular formula C20H13N3O2 and a molecular weight of 327.34 g/mol. Its IUPAC name is 19-hydroxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one.
| Compound Name | 19-hydroxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one |
|---|---|
| PubChem CID | 139589937 |
| Molecular Formula | C20H13N3O2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 19-hydroxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one |
| SMILES | O=C1NCc2c1c1c3ccccc3[nH]c1c1[nH]c3ccc(O)cc3c21 |
| InChI | InChI=1S/C20H13N3O2/c24-9-5-6-14-11(7-9)15-12-8-21-20(25)17(12)16-10-3-1-2-4-13(10)22-19(16)18(15)23-14/h1-7,22-24H,8H2,(H,21,25) |
| InChIKey | ZRXIUWDFOIRCIZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |