About 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one
6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one (PubChem CID 139589958) has the molecular formula C16H26O6
and a molecular weight of 314.38 g/mol. Its IUPAC name is 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one.
Molecular Properties
| Compound Name | 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one |
| PubChem CID | 139589958 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one |
| SMILES | COc1cc([C@@H](O)CCCCCC[C@@H](C)O)oc(=O)c1CO |
| InChI | InChI=1S/C16H26O6/c1-11(18)7-5-3-4-6-8-13(19)15-9-14(21-2)12(10-17)16(20)22-15/h9,11,13,17-19H,3-8,10H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | PBHUUYOELXANAU-YPMHNXCESA-N |
| XLogP | 1.90 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one?
The IUPAC name of 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one (CID 139589958) is 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one.
What is the SMILES notation for 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one?
The canonical SMILES for 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one is COc1cc([C@@H](O)CCCCCC[C@@H](C)O)oc(=O)c1CO.
What is the InChIKey of 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one?
The InChIKey is PBHUUYOELXANAU-YPMHNXCESA-N. The full InChI is InChI=1S/C16H26O6/c1-11(18)7-5-3-4-6-8-13(19)15-9-14(21-2)12(10-17)16(20)22-15/h9,11,13,17-19H,3-8,10H2,1-2H3/t11-,13+/m1/s1.
What are the key properties of 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one?
6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one has a molecular weight of 314.38 g/mol, XLogP of 1.90, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1S,8R)-1,8-dihydroxynonyl]-3-(hydroxymethyl)-4-methoxypyran-2-one is sourced from PubChem (CID 139589958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).