C15H20O2 — CID 139589999
(6R,7aR,7bR)-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,7,7a-tetrahydrocyclobuta[e]inden-4-one (PubChem CID 139589999) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (6R,7aR,7bR)-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,7,7a-tetrahydrocyclobuta[e]inden-4-one.
| Compound Name | (6R,7aR,7bR)-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,7,7a-tetrahydrocyclobuta[e]inden-4-one |
|---|---|
| PubChem CID | 139589999 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (6R,7aR,7bR)-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,7,7a-tetrahydrocyclobuta[e]inden-4-one |
| SMILES | CC1=C2CC[C@]2(C)[C@H]2C[C@@](C)(CO)C=C2C1=O |
| InChI | InChI=1S/C15H20O2/c1-9-11-4-5-15(11,3)12-7-14(2,8-16)6-10(12)13(9)17/h6,12,16H,4-5,7-8H2,1-3H3/t12-,14-,15-/m0/s1 |
| InChIKey | OSGWBVRRDMORNR-QEJZJMRPSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |