C15H20O3 — CID 139590019
(3R,4aR,5S)-3-hydroxy-3-(3-hydroxyprop-1-en-2-yl)-4a,5-dimethyl-5,6-dihydro-4H-naphthalen-2-one (PubChem CID 139590019) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3R,4aR,5S)-3-hydroxy-3-(3-hydroxyprop-1-en-2-yl)-4a,5-dimethyl-5,6-dihydro-4H-naphthalen-2-one.
| Compound Name | (3R,4aR,5S)-3-hydroxy-3-(3-hydroxyprop-1-en-2-yl)-4a,5-dimethyl-5,6-dihydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 139590019 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3R,4aR,5S)-3-hydroxy-3-(3-hydroxyprop-1-en-2-yl)-4a,5-dimethyl-5,6-dihydro-4H-naphthalen-2-one |
| SMILES | C=C(CO)[C@]1(O)C[C@@]2(C)C(=CC1=O)C=CC[C@@H]2C |
| InChI | InChI=1S/C15H20O3/c1-10-5-4-6-12-7-13(17)15(18,11(2)8-16)9-14(10,12)3/h4,6-7,10,16,18H,2,5,8-9H2,1,3H3/t10-,14+,15+/m0/s1 |
| InChIKey | ZLWMXKXCYUUHDB-COLVAYQJSA-N |
| XLogP | 1.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|