C16H26O4 — CID 139590030
(1R,5S,5aS,9aS,9bS)-5-methoxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[g][2]benzofuran-1,9b-diol (PubChem CID 139590030) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1R,5S,5aS,9aS,9bS)-5-methoxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[g][2]benzofuran-1,9b-diol.
| Compound Name | (1R,5S,5aS,9aS,9bS)-5-methoxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[g][2]benzofuran-1,9b-diol |
|---|---|
| PubChem CID | 139590030 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (1R,5S,5aS,9aS,9bS)-5-methoxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[g][2]benzofuran-1,9b-diol |
| SMILES | CO[C@H]1C=C2CO[C@@H](O)[C@]2(O)[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C16H26O4/c1-14(2)6-5-7-15(3)12(14)11(19-4)8-10-9-20-13(17)16(10,15)18/h8,11-13,17-18H,5-7,9H2,1-4H3/t11-,12-,13+,15-,16-/m0/s1 |
| InChIKey | IJHNKNADBVNXOI-IGNRKKQASA-N |
| XLogP | 1.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|