C15H24O5 — CID 139590033
(1R,5R,5aS,6S,9aS,9bS)-6-(hydroxymethyl)-6,9a-dimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[g][2]benzofuran-1,5,9b-triol (PubChem CID 139590033) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1R,5R,5aS,6S,9aS,9bS)-6-(hydroxymethyl)-6,9a-dimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[g][2]benzofuran-1,5,9b-triol.
| Compound Name | (1R,5R,5aS,6S,9aS,9bS)-6-(hydroxymethyl)-6,9a-dimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[g][2]benzofuran-1,5,9b-triol |
|---|---|
| PubChem CID | 139590033 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1R,5R,5aS,6S,9aS,9bS)-6-(hydroxymethyl)-6,9a-dimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[g][2]benzofuran-1,5,9b-triol |
| SMILES | C[C@]1(CO)CCC[C@@]2(C)[C@H]1[C@H](O)C=C1CO[C@@H](O)[C@@]12O |
| InChI | InChI=1S/C15H24O5/c1-13(8-16)4-3-5-14(2)11(13)10(17)6-9-7-20-12(18)15(9,14)19/h6,10-12,16-19H,3-5,7-8H2,1-2H3/t10-,11+,12-,13-,14+,15+/m1/s1 |
| InChIKey | VUJUPKKFSVVPSL-QLKXBERHSA-N |
| XLogP | 0.17 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|