C15H22O4 — CID 139590034
(1R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-1,3,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-one (PubChem CID 139590034) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-1,3,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-one.
| Compound Name | (1R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-1,3,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-one |
|---|---|
| PubChem CID | 139590034 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-1,3,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-one |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1C(=O)C=C1CO[C@@H](O)[C@@]12O |
| InChI | InChI=1S/C15H22O4/c1-13(2)5-4-6-14(3)11(13)10(16)7-9-8-19-12(17)15(9,14)18/h7,11-12,17-18H,4-6,8H2,1-3H3/t11-,12+,14-,15-/m0/s1 |
| InChIKey | FYRPLGHPNVTMAH-NEBZKDRISA-N |
| XLogP | 1.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |