C27H42O7 — CID 139590059
[(2R,5R,6R,13R)-5,13-dihydroxy-14-(5-hydroxy-3,5-dimethyl-4-oxofuran-2-yl)-4,6-dimethyltetradeca-3,7,9-trien-2-yl] pentanoate (PubChem CID 139590059) has the molecular formula C27H42O7 and a molecular weight of 478.63 g/mol. Its IUPAC name is [(2R,5R,6R,13R)-5,13-dihydroxy-14-(5-hydroxy-3,5-dimethyl-4-oxofuran-2-yl)-4,6-dimethyltetradeca-3,7,9-trien-2-yl] pentanoate.
| Compound Name | [(2R,5R,6R,13R)-5,13-dihydroxy-14-(5-hydroxy-3,5-dimethyl-4-oxofuran-2-yl)-4,6-dimethyltetradeca-3,7,9-trien-2-yl] pentanoate |
|---|---|
| PubChem CID | 139590059 |
| Molecular Formula | C27H42O7 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | [(2R,5R,6R,13R)-5,13-dihydroxy-14-(5-hydroxy-3,5-dimethyl-4-oxofuran-2-yl)-4,6-dimethyltetradeca-3,7,9-trien-2-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@H](C)C=C(C)[C@H](O)[C@H](C)C=CC=CCC[C@@H](O)CC1=C(C)C(=O)C(C)(O)O1 |
| InChI | InChI=1S/C27H42O7/c1-7-8-15-24(29)33-20(4)16-19(3)25(30)18(2)13-11-9-10-12-14-22(28)17-23-21(5)26(31)27(6,32)34-23/h9-11,13,16,18,20,22,25,28,30,32H,7-8,12,14-15,17H2,1-6H3/t18-,20-,22-,25-,27?/m1/s1 |
| InChIKey | JIOBJQVDMQELKP-XUIGBLHPSA-N |
| XLogP | 4.28 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|