C21H30O4 — CID 139590070
(1R,2R,3R,4R)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dien-1-ynyl]cyclohex-5-ene-1,2,3,4-tetrol (PubChem CID 139590070) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1R,2R,3R,4R)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dien-1-ynyl]cyclohex-5-ene-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3R,4R)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dien-1-ynyl]cyclohex-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 139590070 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (1R,2R,3R,4R)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dien-1-ynyl]cyclohex-5-ene-1,2,3,4-tetrol |
| SMILES | C=C(C#CC1=C[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H30O4/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-17-13-18(22)20(24)21(25)19(17)23/h7,9,13,18-25H,4-6,8,10H2,1-3H3/b15-9+/t18-,19-,20-,21-/m1/s1 |
| InChIKey | CADYTUXNRNXAES-NYJGJKORSA-N |
| XLogP | 2.40 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|