C12H14O4 — CID 139590213
(2R,3R)-3,5,7-trihydroxy-2,3,6-trimethyl-2H-inden-1-one (PubChem CID 139590213) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2R,3R)-3,5,7-trihydroxy-2,3,6-trimethyl-2H-inden-1-one.
| Compound Name | (2R,3R)-3,5,7-trihydroxy-2,3,6-trimethyl-2H-inden-1-one |
|---|---|
| PubChem CID | 139590213 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2R,3R)-3,5,7-trihydroxy-2,3,6-trimethyl-2H-inden-1-one |
| SMILES | Cc1c(O)cc2c(c1O)C(=O)[C@H](C)[C@@]2(C)O |
| InChI | InChI=1S/C12H14O4/c1-5-8(13)4-7-9(10(5)14)11(15)6(2)12(7,3)16/h4,6,13-14,16H,1-3H3/t6-,12+/m0/s1 |
| InChIKey | NSPXHQZWUDTFPI-PWCHPLFNSA-N |
| XLogP | 1.45 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |