C26H38O8 — CID 139590221
methyl (1S,3Z,5S,7S,8R,9S,11R,14R)-7-hydroxy-17-methoxy-4,7,11,14-tetramethyl-10,16-dioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate (PubChem CID 139590221) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is methyl (1S,3Z,5S,7S,8R,9S,11R,14R)-7-hydroxy-17-methoxy-4,7,11,14-tetramethyl-10,16-dioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate.
| Compound Name | methyl (1S,3Z,5S,7S,8R,9S,11R,14R)-7-hydroxy-17-methoxy-4,7,11,14-tetramethyl-10,16-dioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate |
|---|---|
| PubChem CID | 139590221 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | methyl (1S,3Z,5S,7S,8R,9S,11R,14R)-7-hydroxy-17-methoxy-4,7,11,14-tetramethyl-10,16-dioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C(=O)[C@H](C)CC[C@@]3(C)OC(=O)C(OC)=C(C(C)C)[C@@H]3C/C=C(/C)[C@H]2O[C@]1(C)O |
| InChI | InChI=1S/C26H38O8/c1-13(2)17-16-10-9-15(4)21-18(19(23(28)32-8)26(6,30)33-21)20(27)14(3)11-12-25(16,5)34-24(29)22(17)31-7/h9,13-14,16,18-19,21,30H,10-12H2,1-8H3/b15-9-/t14-,16+,18-,19+,21-,25-,26+/m1/s1 |
| InChIKey | DHYUORJOPDCJCU-JLFNMMFOSA-N |
| XLogP | 3.32 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|