C26H36O8 — CID 139590222
methyl (1S,3Z,5S,8S,9S,11R,14R)-17-methoxy-4,8,11,14-tetramethyl-7,10,16-trioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate (PubChem CID 139590222) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is methyl (1S,3Z,5S,8S,9S,11R,14R)-17-methoxy-4,8,11,14-tetramethyl-7,10,16-trioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate.
| Compound Name | methyl (1S,3Z,5S,8S,9S,11R,14R)-17-methoxy-4,8,11,14-tetramethyl-7,10,16-trioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate |
|---|---|
| PubChem CID | 139590222 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | methyl (1S,3Z,5S,8S,9S,11R,14R)-17-methoxy-4,8,11,14-tetramethyl-7,10,16-trioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C(=O)O[C@@H]2/C(C)=C\C[C@H]3C(C(C)C)=C(OC)C(=O)O[C@]3(C)CC[C@@H](C)C(=O)[C@H]21 |
| InChI | InChI=1S/C26H36O8/c1-13(2)17-16-10-9-15(4)20-18(26(6,23(29)32-8)24(30)33-20)19(27)14(3)11-12-25(16,5)34-22(28)21(17)31-7/h9,13-14,16,18,20H,10-12H2,1-8H3/b15-9-/t14-,16+,18-,20-,25-,26+/m1/s1 |
| InChIKey | PECJFSSLYKTHRU-FAMBKVPISA-N |
| XLogP | 3.53 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|