C26H38O7 — CID 139590223
methyl (1S,3Z,5S,7S,8R,9S,11R,14R)-17-methoxy-4,7,11,14-tetramethyl-10,16-dioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate (PubChem CID 139590223) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is methyl (1S,3Z,5S,7S,8R,9S,11R,14R)-17-methoxy-4,7,11,14-tetramethyl-10,16-dioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate.
| Compound Name | methyl (1S,3Z,5S,7S,8R,9S,11R,14R)-17-methoxy-4,7,11,14-tetramethyl-10,16-dioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate |
|---|---|
| PubChem CID | 139590223 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | methyl (1S,3Z,5S,7S,8R,9S,11R,14R)-17-methoxy-4,7,11,14-tetramethyl-10,16-dioxo-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-8-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C(=O)[C@H](C)CC[C@@]3(C)OC(=O)C(OC)=C(C(C)C)[C@@H]3C/C=C(/C)[C@H]2O[C@H]1C |
| InChI | InChI=1S/C26H38O7/c1-13(2)18-17-10-9-15(4)22-20(19(16(5)32-22)24(28)31-8)21(27)14(3)11-12-26(17,6)33-25(29)23(18)30-7/h9,13-14,16-17,19-20,22H,10-12H2,1-8H3/b15-9-/t14-,16+,17+,19+,20-,22-,26-/m1/s1 |
| InChIKey | LSTJWLLNXDOMDA-HQJBUUCBSA-N |
| XLogP | 4.00 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|