C23H32O6 — CID 139590225
(1S,3Z,5S,9S,11R,14R)-17-methoxy-4,11,14-trimethyl-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-7,10,16-trione (PubChem CID 139590225) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is (1S,3Z,5S,9S,11R,14R)-17-methoxy-4,11,14-trimethyl-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-7,10,16-trione.
| Compound Name | (1S,3Z,5S,9S,11R,14R)-17-methoxy-4,11,14-trimethyl-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-7,10,16-trione |
|---|---|
| PubChem CID | 139590225 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (1S,3Z,5S,9S,11R,14R)-17-methoxy-4,11,14-trimethyl-18-propan-2-yl-6,15-dioxatricyclo[12.4.0.05,9]octadeca-3,17-diene-7,10,16-trione |
| SMILES | COC1=C(C(C)C)[C@@H]2C/C=C(/C)[C@H]3OC(=O)C[C@@H]3C(=O)[C@H](C)CC[C@@]2(C)OC1=O |
| InChI | InChI=1S/C23H32O6/c1-12(2)18-16-8-7-14(4)20-15(11-17(24)28-20)19(25)13(3)9-10-23(16,5)29-22(26)21(18)27-6/h7,12-13,15-16,20H,8-11H2,1-6H3/b14-7-/t13-,15-,16+,20-,23-/m1/s1 |
| InChIKey | LDNGIXCVOPOZFN-LWEBIHICSA-N |
| XLogP | 3.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|