C15H26O4 — CID 139590231
(1R,2R,5R,6R)-6-[(3S)-3,4-dihydroxy-4-methylpentyl]-2-hydroxy-2,6-dimethylbicyclo[3.1.1]heptan-3-one (PubChem CID 139590231) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1R,2R,5R,6R)-6-[(3S)-3,4-dihydroxy-4-methylpentyl]-2-hydroxy-2,6-dimethylbicyclo[3.1.1]heptan-3-one.
| Compound Name | (1R,2R,5R,6R)-6-[(3S)-3,4-dihydroxy-4-methylpentyl]-2-hydroxy-2,6-dimethylbicyclo[3.1.1]heptan-3-one |
|---|---|
| PubChem CID | 139590231 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1R,2R,5R,6R)-6-[(3S)-3,4-dihydroxy-4-methylpentyl]-2-hydroxy-2,6-dimethylbicyclo[3.1.1]heptan-3-one |
| SMILES | CC(C)(O)[C@@H](O)CC[C@]1(C)[C@H]2CC(=O)[C@](C)(O)[C@@H]1C2 |
| InChI | InChI=1S/C15H26O4/c1-13(2,18)11(16)5-6-14(3)9-7-10(14)15(4,19)12(17)8-9/h9-11,16,18-19H,5-8H2,1-4H3/t9-,10-,11+,14-,15-/m1/s1 |
| InChIKey | JIZQPOREVYSPIW-IUPFNGILSA-N |
| XLogP | 1.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |