C20H34O4 — CID 139590431
(2R,3R,4E,6S,8E,10E,12E,15R,16S)-3,5-dimethyloctadeca-4,8,10,12-tetraene-2,6,15,16-tetrol (PubChem CID 139590431) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (2R,3R,4E,6S,8E,10E,12E,15R,16S)-3,5-dimethyloctadeca-4,8,10,12-tetraene-2,6,15,16-tetrol.
| Compound Name | (2R,3R,4E,6S,8E,10E,12E,15R,16S)-3,5-dimethyloctadeca-4,8,10,12-tetraene-2,6,15,16-tetrol |
|---|---|
| PubChem CID | 139590431 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (2R,3R,4E,6S,8E,10E,12E,15R,16S)-3,5-dimethyloctadeca-4,8,10,12-tetraene-2,6,15,16-tetrol |
| SMILES | CC[C@H](O)[C@H](O)C/C=C/C=C/C=C/C[C@H](O)/C(C)=C/[C@@H](C)[C@@H](C)O |
| InChI | InChI=1S/C20H34O4/c1-5-18(22)20(24)13-11-9-7-6-8-10-12-19(23)16(3)14-15(2)17(4)21/h6-11,14-15,17-24H,5,12-13H2,1-4H3/b7-6+,10-8+,11-9+,16-14+/t15-,17-,18+,19+,20-/m1/s1 |
| InChIKey | GOELIYKZTRQWFB-XCUVDTPKSA-N |
| XLogP | 2.89 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|