C15H22O3 — CID 139590437
(4aS,6aR,7R,8S,10aS,10bR)-7-hydroxy-4a,8-dimethyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one (PubChem CID 139590437) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (4aS,6aR,7R,8S,10aS,10bR)-7-hydroxy-4a,8-dimethyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one.
| Compound Name | (4aS,6aR,7R,8S,10aS,10bR)-7-hydroxy-4a,8-dimethyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one |
|---|---|
| PubChem CID | 139590437 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (4aS,6aR,7R,8S,10aS,10bR)-7-hydroxy-4a,8-dimethyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one |
| SMILES | C[C@H]1CC[C@H]2[C@@H](C=C[C@]3(C)OCCC(=O)[C@H]23)[C@@H]1O |
| InChI | InChI=1S/C15H22O3/c1-9-3-4-10-11(14(9)17)5-7-15(2)13(10)12(16)6-8-18-15/h5,7,9-11,13-14,17H,3-4,6,8H2,1-2H3/t9-,10-,11+,13-,14+,15-/m0/s1 |
| InChIKey | SXWHMODLLRVTPT-FYNNSYDNSA-N |
| XLogP | 1.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|