C15H22O2 — CID 139590440
(4aS,6aR,8S,10aS,10bR)-4a,8-dimethyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one (PubChem CID 139590440) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4aS,6aR,8S,10aS,10bR)-4a,8-dimethyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one.
| Compound Name | (4aS,6aR,8S,10aS,10bR)-4a,8-dimethyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one |
|---|---|
| PubChem CID | 139590440 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (4aS,6aR,8S,10aS,10bR)-4a,8-dimethyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one |
| SMILES | C[C@H]1CC[C@@H]2[C@H]3C(=O)CCO[C@@]3(C)C=C[C@H]2C1 |
| InChI | InChI=1S/C15H22O2/c1-10-3-4-12-11(9-10)5-7-15(2)14(12)13(16)6-8-17-15/h5,7,10-12,14H,3-4,6,8-9H2,1-2H3/t10-,11-,12-,14-,15-/m0/s1 |
| InChIKey | RMXWBAZVHFTPRY-YLXLXVFQSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|