C15H24O5 — CID 139590441
(4aR,5S,6R,6aR,7R,8S,10aS,10bR)-5,6,7-trihydroxy-4a,8-dimethyl-3,5,6,6a,7,8,9,10,10a,10b-decahydro-2H-benzo[f]chromen-1-one (PubChem CID 139590441) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (4aR,5S,6R,6aR,7R,8S,10aS,10bR)-5,6,7-trihydroxy-4a,8-dimethyl-3,5,6,6a,7,8,9,10,10a,10b-decahydro-2H-benzo[f]chromen-1-one.
| Compound Name | (4aR,5S,6R,6aR,7R,8S,10aS,10bR)-5,6,7-trihydroxy-4a,8-dimethyl-3,5,6,6a,7,8,9,10,10a,10b-decahydro-2H-benzo[f]chromen-1-one |
|---|---|
| PubChem CID | 139590441 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (4aR,5S,6R,6aR,7R,8S,10aS,10bR)-5,6,7-trihydroxy-4a,8-dimethyl-3,5,6,6a,7,8,9,10,10a,10b-decahydro-2H-benzo[f]chromen-1-one |
| SMILES | C[C@H]1CC[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@]3(C)OCCC(=O)[C@H]23)[C@@H]1O |
| InChI | InChI=1S/C15H24O5/c1-7-3-4-8-10(12(7)17)13(18)14(19)15(2)11(8)9(16)5-6-20-15/h7-8,10-14,17-19H,3-6H2,1-2H3/t7-,8-,10+,11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | YTNJAFPSFOXFGG-NRZOJRDLSA-N |
| XLogP | 0.11 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |