C15H22O3 — CID 139590445
1-[(1R,4aR,5R,6S,8aS)-5-hydroxy-6-methyl-2-methylidene-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-hydroxypropan-1-one (PubChem CID 139590445) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[(1R,4aR,5R,6S,8aS)-5-hydroxy-6-methyl-2-methylidene-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-hydroxypropan-1-one.
| Compound Name | 1-[(1R,4aR,5R,6S,8aS)-5-hydroxy-6-methyl-2-methylidene-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 139590445 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-[(1R,4aR,5R,6S,8aS)-5-hydroxy-6-methyl-2-methylidene-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-hydroxypropan-1-one |
| SMILES | C=C1C=C[C@H]2[C@H](O)[C@@H](C)CC[C@@H]2[C@H]1C(=O)CCO |
| InChI | InChI=1S/C15H22O3/c1-9-3-6-12-11(5-4-10(2)15(12)18)14(9)13(17)7-8-16/h3,6,10-12,14-16,18H,1,4-5,7-8H2,2H3/t10-,11-,12+,14-,15+/m0/s1 |
| InChIKey | VERHFCHINWYQLU-ZZVJUGKHSA-N |
| XLogP | 1.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |