About (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one
(5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one (PubChem CID 139590454) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one.
Molecular Properties
| Compound Name | (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one |
| PubChem CID | 139590454 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one |
| SMILES | CC1=CC[C@@](C)([C@@]2(C)CCC(=O)O2)C[C@@H]1O |
| InChI | InChI=1S/C13H20O3/c1-9-4-6-12(2,8-10(9)14)13(3)7-5-11(15)16-13/h4,10,14H,5-8H2,1-3H3/t10-,12+,13+/m0/s1 |
| InChIKey | ZZSQTJIXLRIEOU-CYZMBNFOSA-N |
| XLogP | 2.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one?
The IUPAC name of (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one (CID 139590454) is (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one.
What is the SMILES notation for (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one?
The canonical SMILES for (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one is CC1=CC[C@@](C)([C@@]2(C)CCC(=O)O2)C[C@@H]1O.
What is the InChIKey of (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one?
The InChIKey is ZZSQTJIXLRIEOU-CYZMBNFOSA-N. The full InChI is InChI=1S/C13H20O3/c1-9-4-6-12(2,8-10(9)14)13(3)7-5-11(15)16-13/h4,10,14H,5-8H2,1-3H3/t10-,12+,13+/m0/s1.
What are the key properties of (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one?
(5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one has a molecular weight of 224.30 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[(1R,5S)-5-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-5-methyloxolan-2-one is sourced from PubChem (CID 139590454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).