C28H40O3 — CID 139590474
(1R,3R,10R,11R,14R,15R,18R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadec-5-ene-4,7-dione (PubChem CID 139590474) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is (1R,3R,10R,11R,14R,15R,18R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadec-5-ene-4,7-dione.
| Compound Name | (1R,3R,10R,11R,14R,15R,18R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadec-5-ene-4,7-dione |
|---|---|
| PubChem CID | 139590474 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (1R,3R,10R,11R,14R,15R,18R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadec-5-ene-4,7-dione |
| SMILES | CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@]23O[C@H]3C(=O)C2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C28H40O3/c1-16(2)17(3)7-8-18(4)20-9-10-22-26(20,5)14-12-23-27(6)13-11-19(29)15-21(27)24(30)25-28(22,23)31-25/h7-8,15-18,20,22-23,25H,9-14H2,1-6H3/b8-7+/t17-,18+,20+,22+,23+,25-,26+,27-,28+/m0/s1 |
| InChIKey | APUOKZOJSMYJCH-RKVYFYKZSA-N |
| XLogP | 5.93 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|