C27H31NO5 — CID 139590513
3-[(1R,2S,4aS,7S,8aR)-1-[(E)-3-hydroxyprop-1-enyl]-4,7-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one (PubChem CID 139590513) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is 3-[(1R,2S,4aS,7S,8aR)-1-[(E)-3-hydroxyprop-1-enyl]-4,7-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one.
| Compound Name | 3-[(1R,2S,4aS,7S,8aR)-1-[(E)-3-hydroxyprop-1-enyl]-4,7-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 139590513 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 3-[(1R,2S,4aS,7S,8aR)-1-[(E)-3-hydroxyprop-1-enyl]-4,7-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
| SMILES | CC1=C[C@@H](C(=O)c2c(O)c(-c3ccc(O)cc3)c[nH]c2=O)[C@H](/C=C/CO)[C@H]2C[C@@H](C)CC[C@H]12 |
| InChI | InChI=1S/C27H31NO5/c1-15-5-10-19-16(2)13-22(20(4-3-11-29)21(19)12-15)25(31)24-26(32)23(14-28-27(24)33)17-6-8-18(30)9-7-17/h3-4,6-9,13-15,19-22,29-30H,5,10-12H2,1-2H3,(H2,28,32,33)/b4-3+/t15-,19+,20+,21-,22+/m0/s1 |
| InChIKey | SXNAFBWBFSABTB-GUGMBJANSA-N |
| XLogP | 4.43 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|