C13H23NO2 — CID 139590538
(2Z,4E)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-methylhexa-2,4-dienamide (PubChem CID 139590538) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (2Z,4E)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-methylhexa-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-methylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 139590538 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (2Z,4E)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-methylhexa-2,4-dienamide |
| SMILES | C/C=C/C=C(/C)C(=O)N[C@H](CO)CC(C)C |
| InChI | InChI=1S/C13H23NO2/c1-5-6-7-11(4)13(16)14-12(9-15)8-10(2)3/h5-7,10,12,15H,8-9H2,1-4H3,(H,14,16)/b6-5+,11-7-/t12-/m0/s1 |
| InChIKey | BITFKLCIIJKNRC-SEZUGVTOSA-N |
| XLogP | 2.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|