C16H24O2 — CID 139590542
(1R,2R,3R)-7-[(2S)-2-hydroxypropyl]-1,3,6-trimethyl-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 139590542) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R,2R,3R)-7-[(2S)-2-hydroxypropyl]-1,3,6-trimethyl-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (1R,2R,3R)-7-[(2S)-2-hydroxypropyl]-1,3,6-trimethyl-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 139590542 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1R,2R,3R)-7-[(2S)-2-hydroxypropyl]-1,3,6-trimethyl-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | Cc1cc2c(cc1C[C@H](C)O)[C@@H](C)[C@H](O)[C@H](C)C2 |
| InChI | InChI=1S/C16H24O2/c1-9-5-14-6-10(2)16(18)12(4)15(14)8-13(9)7-11(3)17/h5,8,10-12,16-18H,6-7H2,1-4H3/t10-,11+,12-,16-/m1/s1 |
| InChIKey | JHDZFWRABRBPFB-AZKPJATDSA-N |
| XLogP | 2.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |