About 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol
7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol (PubChem CID 139590543) has the molecular formula C21H18O6
and a molecular weight of 366.37 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol.
Molecular Properties
| Compound Name | 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol |
| PubChem CID | 139590543 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol |
| SMILES | COc1cc2oc3c(OC)c(-c4ccc(O)cc4)cc(OC)c3c2cc1O |
| InChI | InChI=1S/C21H18O6/c1-24-17-10-16-14(8-15(17)23)19-18(25-2)9-13(20(26-3)21(19)27-16)11-4-6-12(22)7-5-11/h4-10,22-23H,1-3H3 |
| InChIKey | QOPBYJBEUNTVLD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol?
The IUPAC name of 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol (CID 139590543) is 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol.
What is the SMILES notation for 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol?
The canonical SMILES for 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol is COc1cc2oc3c(OC)c(-c4ccc(O)cc4)cc(OC)c3c2cc1O.
What is the InChIKey of 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol?
The InChIKey is QOPBYJBEUNTVLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O6/c1-24-17-10-16-14(8-15(17)23)19-18(25-2)9-13(20(26-3)21(19)27-16)11-4-6-12(22)7-5-11/h4-10,22-23H,1-3H3.
What are the key properties of 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol?
7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol has a molecular weight of 366.37 g/mol, XLogP of 4.69, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-hydroxyphenyl)-3,6,9-trimethoxydibenzofuran-2-ol is sourced from PubChem (CID 139590543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).