C25H39NO6 — CID 139590579
(2S,3S)-2-[(1E,3R,4R,6R,7Z,9Z)-3-(2-aminoethyl)-3,4,6-trihydroxy-10-[(1R,3S)-3-hydroxycyclohexyl]deca-1,7,9-trienyl]-3-ethyl-2,3-dihydropyran-6-one (PubChem CID 139590579) has the molecular formula C25H39NO6 and a molecular weight of 449.59 g/mol. Its IUPAC name is (2S,3S)-2-[(1E,3R,4R,6R,7Z,9Z)-3-(2-aminoethyl)-3,4,6-trihydroxy-10-[(1R,3S)-3-hydroxycyclohexyl]deca-1,7,9-trienyl]-3-ethyl-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2-[(1E,3R,4R,6R,7Z,9Z)-3-(2-aminoethyl)-3,4,6-trihydroxy-10-[(1R,3S)-3-hydroxycyclohexyl]deca-1,7,9-trienyl]-3-ethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 139590579 |
| Molecular Formula | C25H39NO6 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | (2S,3S)-2-[(1E,3R,4R,6R,7Z,9Z)-3-(2-aminoethyl)-3,4,6-trihydroxy-10-[(1R,3S)-3-hydroxycyclohexyl]deca-1,7,9-trienyl]-3-ethyl-2,3-dihydropyran-6-one |
| SMILES | CC[C@H]1C=CC(=O)O[C@H]1/C=C/[C@](O)(CCN)[C@H](O)C[C@@H](O)/C=C\C=C/[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C25H39NO6/c1-2-19-10-11-24(30)32-22(19)12-13-25(31,14-15-26)23(29)17-21(28)8-4-3-6-18-7-5-9-20(27)16-18/h3-4,6,8,10-13,18-23,27-29,31H,2,5,7,9,14-17,26H2,1H3/b6-3-,8-4-,13-12+/t18-,19+,20+,21+,22+,23-,25+/m1/s1 |
| InChIKey | WAEFDBPQINDPOQ-OVPPXBFPSA-N |
| XLogP | 1.91 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|