C9H16O3 — CID 139590656
(Z,4S)-7-hydroxy-4-methyloct-5-enoic acid (PubChem CID 139590656) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (Z,4S)-7-hydroxy-4-methyloct-5-enoic acid.
| Compound Name | (Z,4S)-7-hydroxy-4-methyloct-5-enoic acid |
|---|---|
| PubChem CID | 139590656 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (Z,4S)-7-hydroxy-4-methyloct-5-enoic acid |
| SMILES | CC(O)/C=C\[C@@H](C)CCC(=O)O |
| InChI | InChI=1S/C9H16O3/c1-7(3-5-8(2)10)4-6-9(11)12/h3,5,7-8,10H,4,6H2,1-2H3,(H,11,12)/b5-3-/t7-,8?/m1/s1 |
| InChIKey | SKMJTYRKOIIVFF-MHTMNENMSA-N |
| XLogP | 1.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|