C22H24O4 — CID 139590668
(1R,3R,4S,7S)-3-hydroxy-5-(1-hydroxyhexa-2,4-dienylidene)-1,3-dimethyl-7-phenylbicyclo[2.2.2]octane-2,6-dione (PubChem CID 139590668) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is (1R,3R,4S,7S)-3-hydroxy-5-(1-hydroxyhexa-2,4-dienylidene)-1,3-dimethyl-7-phenylbicyclo[2.2.2]octane-2,6-dione.
| Compound Name | (1R,3R,4S,7S)-3-hydroxy-5-(1-hydroxyhexa-2,4-dienylidene)-1,3-dimethyl-7-phenylbicyclo[2.2.2]octane-2,6-dione |
|---|---|
| PubChem CID | 139590668 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (1R,3R,4S,7S)-3-hydroxy-5-(1-hydroxyhexa-2,4-dienylidene)-1,3-dimethyl-7-phenylbicyclo[2.2.2]octane-2,6-dione |
| SMILES | CC=CC=CC(O)=C1C(=O)[C@]2(C)C(=O)[C@](C)(O)[C@H]1C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C22H24O4/c1-4-5-7-12-17(23)18-16-13-15(14-10-8-6-9-11-14)21(2,19(18)24)20(25)22(16,3)26/h4-12,15-16,23,26H,13H2,1-3H3/t15-,16-,21+,22+/m0/s1 |
| InChIKey | BYTNTFUMKVJFHV-RZTYQLBFSA-N |
| XLogP | 3.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|