C22H24O5 — CID 139590669
(1R,3R,4S,7S)-5-(1,6-dihydroxyhexa-2,4-dienylidene)-3-hydroxy-1,3-dimethyl-7-phenylbicyclo[2.2.2]octane-2,6-dione (PubChem CID 139590669) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is (1R,3R,4S,7S)-5-(1,6-dihydroxyhexa-2,4-dienylidene)-3-hydroxy-1,3-dimethyl-7-phenylbicyclo[2.2.2]octane-2,6-dione.
| Compound Name | (1R,3R,4S,7S)-5-(1,6-dihydroxyhexa-2,4-dienylidene)-3-hydroxy-1,3-dimethyl-7-phenylbicyclo[2.2.2]octane-2,6-dione |
|---|---|
| PubChem CID | 139590669 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (1R,3R,4S,7S)-5-(1,6-dihydroxyhexa-2,4-dienylidene)-3-hydroxy-1,3-dimethyl-7-phenylbicyclo[2.2.2]octane-2,6-dione |
| SMILES | C[C@]12C(=O)C(=C(O)C=CC=CCO)[C@H](C[C@H]1c1ccccc1)[C@@](C)(O)C2=O |
| InChI | InChI=1S/C22H24O5/c1-21-15(14-9-5-3-6-10-14)13-16(22(2,27)20(21)26)18(19(21)25)17(24)11-7-4-8-12-23/h3-11,15-16,23-24,27H,12-13H2,1-2H3/t15-,16-,21+,22+/m0/s1 |
| InChIKey | ZUBZPOISGUHSQT-RZTYQLBFSA-N |
| XLogP | 2.62 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|