C14H18O5 — CID 139590671
(5S)-4-hydroxy-5-[(4E,6E)-8-hydroxy-3-oxoocta-4,6-dienyl]-3,5-dimethylfuran-2-one (PubChem CID 139590671) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (5S)-4-hydroxy-5-[(4E,6E)-8-hydroxy-3-oxoocta-4,6-dienyl]-3,5-dimethylfuran-2-one.
| Compound Name | (5S)-4-hydroxy-5-[(4E,6E)-8-hydroxy-3-oxoocta-4,6-dienyl]-3,5-dimethylfuran-2-one |
|---|---|
| PubChem CID | 139590671 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (5S)-4-hydroxy-5-[(4E,6E)-8-hydroxy-3-oxoocta-4,6-dienyl]-3,5-dimethylfuran-2-one |
| SMILES | CC1=C(O)[C@](C)(CCC(=O)/C=C/C=C/CO)OC1=O |
| InChI | InChI=1S/C14H18O5/c1-10-12(17)14(2,19-13(10)18)8-7-11(16)6-4-3-5-9-15/h3-6,15,17H,7-9H2,1-2H3/b5-3+,6-4+/t14-/m0/s1 |
| InChIKey | JGLRCUKABZRXIW-NWHMWQLCSA-N |
| XLogP | 1.59 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|