C19H26O5 — CID 139590753
10-[(1R)-1-hydroxy-4-methyl-2,5-dioxocyclohex-3-en-1-yl]-4,8-dimethyldeca-4,8-dienoic acid (PubChem CID 139590753) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is 10-[(1R)-1-hydroxy-4-methyl-2,5-dioxocyclohex-3-en-1-yl]-4,8-dimethyldeca-4,8-dienoic acid.
| Compound Name | 10-[(1R)-1-hydroxy-4-methyl-2,5-dioxocyclohex-3-en-1-yl]-4,8-dimethyldeca-4,8-dienoic acid |
|---|---|
| PubChem CID | 139590753 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 10-[(1R)-1-hydroxy-4-methyl-2,5-dioxocyclohex-3-en-1-yl]-4,8-dimethyldeca-4,8-dienoic acid |
| SMILES | CC(=CC[C@@]1(O)CC(=O)C(C)=CC1=O)CCC=C(C)CCC(=O)O |
| InChI | InChI=1S/C19H26O5/c1-13(7-8-18(22)23)5-4-6-14(2)9-10-19(24)12-16(20)15(3)11-17(19)21/h5,9,11,24H,4,6-8,10,12H2,1-3H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | NUBNMOKMSXKSKF-LJQANCHMSA-N |
| XLogP | 3.13 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|