C15H22O3 — CID 139590760
(5R,6S)-5-hydroxy-1,1,5-trimethyl-4-oxospiro[5.5]undec-9-ene-9-carbaldehyde (PubChem CID 139590760) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (5R,6S)-5-hydroxy-1,1,5-trimethyl-4-oxospiro[5.5]undec-9-ene-9-carbaldehyde.
| Compound Name | (5R,6S)-5-hydroxy-1,1,5-trimethyl-4-oxospiro[5.5]undec-9-ene-9-carbaldehyde |
|---|---|
| PubChem CID | 139590760 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (5R,6S)-5-hydroxy-1,1,5-trimethyl-4-oxospiro[5.5]undec-9-ene-9-carbaldehyde |
| SMILES | CC1(C)CCC(=O)[C@](C)(O)[C@@]12CC=C(C=O)CC2 |
| InChI | InChI=1S/C15H22O3/c1-13(2)7-6-12(17)14(3,18)15(13)8-4-11(10-16)5-9-15/h4,10,18H,5-9H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | BYNRBVNOJKSHKI-LSDHHAIUSA-N |
| XLogP | 2.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|