C15H24O3 — CID 139590769
(6R)-4-hydroxy-9-(hydroxymethyl)-1,5,5-trimethylspiro[5.5]undec-9-en-2-one (PubChem CID 139590769) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (6R)-4-hydroxy-9-(hydroxymethyl)-1,5,5-trimethylspiro[5.5]undec-9-en-2-one.
| Compound Name | (6R)-4-hydroxy-9-(hydroxymethyl)-1,5,5-trimethylspiro[5.5]undec-9-en-2-one |
|---|---|
| PubChem CID | 139590769 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (6R)-4-hydroxy-9-(hydroxymethyl)-1,5,5-trimethylspiro[5.5]undec-9-en-2-one |
| SMILES | CC1C(=O)CC(O)C(C)(C)[C@]12CC=C(CO)CC2 |
| InChI | InChI=1S/C15H24O3/c1-10-12(17)8-13(18)14(2,3)15(10)6-4-11(9-16)5-7-15/h4,10,13,16,18H,5-9H2,1-3H3/t10?,13?,15-/m0/s1 |
| InChIKey | IVAZEZHNXPTPQF-KHXKVGHRSA-N |
| XLogP | 2.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|