C16H24O2 — CID 139590778
7-(4-hydroxybut-2-en-2-yl)-1,1-dimethyl-3,5,6,7-tetrahydro-2H-naphthalen-2-ol (PubChem CID 139590778) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 7-(4-hydroxybut-2-en-2-yl)-1,1-dimethyl-3,5,6,7-tetrahydro-2H-naphthalen-2-ol.
| Compound Name | 7-(4-hydroxybut-2-en-2-yl)-1,1-dimethyl-3,5,6,7-tetrahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 139590778 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 7-(4-hydroxybut-2-en-2-yl)-1,1-dimethyl-3,5,6,7-tetrahydro-2H-naphthalen-2-ol |
| SMILES | CC(=CCO)C1C=C2C(=CCC(O)C2(C)C)CC1 |
| InChI | InChI=1S/C16H24O2/c1-11(8-9-17)13-5-4-12-6-7-15(18)16(2,3)14(12)10-13/h6,8,10,13,15,17-18H,4-5,7,9H2,1-3H3 |
| InChIKey | YOAXHSPUOPMCPG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|