C15H20O2 — CID 139590781
(1aS,7S,7aS,7bR)-3-hydroxy-1,1,7,7a-tetramethyl-1a,6,7,7b-tetrahydrocyclopropa[a]naphthalen-2-one (PubChem CID 139590781) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1aS,7S,7aS,7bR)-3-hydroxy-1,1,7,7a-tetramethyl-1a,6,7,7b-tetrahydrocyclopropa[a]naphthalen-2-one.
| Compound Name | (1aS,7S,7aS,7bR)-3-hydroxy-1,1,7,7a-tetramethyl-1a,6,7,7b-tetrahydrocyclopropa[a]naphthalen-2-one |
|---|---|
| PubChem CID | 139590781 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1aS,7S,7aS,7bR)-3-hydroxy-1,1,7,7a-tetramethyl-1a,6,7,7b-tetrahydrocyclopropa[a]naphthalen-2-one |
| SMILES | C[C@H]1CC=CC2=C(O)C(=O)[C@H]3[C@H](C3(C)C)[C@@]21C |
| InChI | InChI=1S/C15H20O2/c1-8-6-5-7-9-11(16)12(17)10-13(14(10,2)3)15(8,9)4/h5,7-8,10,13,16H,6H2,1-4H3/t8-,10-,13+,15+/m0/s1 |
| InChIKey | VRXRXQBGHXYMBN-KAKFMGRLSA-N |
| XLogP | 3.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |