C18H26O6 — CID 139590831
(E)-4-[(1R,2R,6R)-3-[(E)-hept-1-enyl]-1,2,6-trihydroxy-5-oxocyclohex-3-en-1-yl]-2-methylbut-2-enoic acid (PubChem CID 139590831) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is (E)-4-[(1R,2R,6R)-3-[(E)-hept-1-enyl]-1,2,6-trihydroxy-5-oxocyclohex-3-en-1-yl]-2-methylbut-2-enoic acid.
| Compound Name | (E)-4-[(1R,2R,6R)-3-[(E)-hept-1-enyl]-1,2,6-trihydroxy-5-oxocyclohex-3-en-1-yl]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 139590831 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (E)-4-[(1R,2R,6R)-3-[(E)-hept-1-enyl]-1,2,6-trihydroxy-5-oxocyclohex-3-en-1-yl]-2-methylbut-2-enoic acid |
| SMILES | CCCCC/C=C/C1=CC(=O)[C@H](O)[C@@](O)(C/C=C(\C)C(=O)O)[C@@H]1O |
| InChI | InChI=1S/C18H26O6/c1-3-4-5-6-7-8-13-11-14(19)16(21)18(24,15(13)20)10-9-12(2)17(22)23/h7-9,11,15-16,20-21,24H,3-6,10H2,1-2H3,(H,22,23)/b8-7+,12-9+/t15-,16+,18-/m1/s1 |
| InChIKey | KUKDHFMUSAZTFT-VUJWGYGCSA-N |
| XLogP | 1.51 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|