About methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate
methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate (PubChem CID 139590896) has the molecular formula C15H24O4
and a molecular weight of 268.35 g/mol. Its IUPAC name is methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate.
Molecular Properties
| Compound Name | methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate |
| PubChem CID | 139590896 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate |
| SMILES | COC(=O)CCC(=O)/C=C/[C@H](CCC(C)=O)C(C)C |
| InChI | InChI=1S/C15H24O4/c1-11(2)13(6-5-12(3)16)7-8-14(17)9-10-15(18)19-4/h7-8,11,13H,5-6,9-10H2,1-4H3/b8-7+/t13-/m0/s1 |
| InChIKey | OIOHFXVFNXRYPX-GWJCSSMESA-N |
| XLogP | 2.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate?
The IUPAC name of methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate (CID 139590896) is methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate.
What is the SMILES notation for methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate?
The canonical SMILES for methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate is COC(=O)CCC(=O)/C=C/[C@H](CCC(C)=O)C(C)C.
What is the InChIKey of methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate?
The InChIKey is OIOHFXVFNXRYPX-GWJCSSMESA-N. The full InChI is InChI=1S/C15H24O4/c1-11(2)13(6-5-12(3)16)7-8-14(17)9-10-15(18)19-4/h7-8,11,13H,5-6,9-10H2,1-4H3/b8-7+/t13-/m0/s1.
What are the key properties of methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate?
methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate has a molecular weight of 268.35 g/mol, XLogP of 2.71, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E,7R)-4,10-dioxo-7-propan-2-ylundec-5-enoate is sourced from PubChem (CID 139590896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).