C23H24O7 — CID 139590899
(1R,2R,10S,13R,15R,18R,19S)-7,7,13,18-tetramethylspiro[6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-2,2'-oxirane]-5,17-dione (PubChem CID 139590899) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is (1R,2R,10S,13R,15R,18R,19S)-7,7,13,18-tetramethylspiro[6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-2,2'-oxirane]-5,17-dione.
| Compound Name | (1R,2R,10S,13R,15R,18R,19S)-7,7,13,18-tetramethylspiro[6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-2,2'-oxirane]-5,17-dione |
|---|---|
| PubChem CID | 139590899 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (1R,2R,10S,13R,15R,18R,19S)-7,7,13,18-tetramethylspiro[6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-2,2'-oxirane]-5,17-dione |
| SMILES | C[C@H]1O[C@@H]2OC(=O)[C@]3(C)C[C@@H]4C5C(=C1O[C@H]5C=C1C(=CC(=O)OC1(C)C)[C@@]41CO1)[C@H]23 |
| InChI | InChI=1S/C23H24O7/c1-9-18-16-15-12(7-22(4)17(16)19(27-9)29-20(22)25)23(8-26-23)11-6-14(24)30-21(2,3)10(11)5-13(15)28-18/h5-6,9,12-13,15,17,19H,7-8H2,1-4H3/t9-,12-,13+,15?,17-,19-,22-,23+/m1/s1 |
| InChIKey | WCTLLUQPCVNPKU-MUGZIZBGSA-N |
| XLogP | 2.17 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|