C15H28O4 — CID 139590990
2-[(2S,5R)-5-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-5-methyloxolan-2-yl]propane-1,2-diol (PubChem CID 139590990) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-[(2S,5R)-5-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-5-methyloxolan-2-yl]propane-1,2-diol.
| Compound Name | 2-[(2S,5R)-5-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-5-methyloxolan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 139590990 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-[(2S,5R)-5-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-5-methyloxolan-2-yl]propane-1,2-diol |
| SMILES | C[C@H]1[C@H]([C@@]2(C)CC[C@@H](C(C)(O)CO)O2)CC[C@@]1(C)O |
| InChI | InChI=1S/C15H28O4/c1-10-11(5-7-13(10,2)17)15(4)8-6-12(19-15)14(3,18)9-16/h10-12,16-18H,5-9H2,1-4H3/t10-,11+,12-,13+,14?,15+/m0/s1 |
| InChIKey | BAVIKCCFWXFUME-AQSJMSBDSA-N |
| XLogP | 1.46 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |