C28H39NO6 — CID 139591095
(1R,2E,4S,5R,6S,7S,9R,10E,12E,14E,16S,17S,18S,19R,21S,24S)-5,6,7,9,19-pentahydroxy-4,14,21-trimethyl-22-azatetracyclo[14.10.0.017,24.018,22]hexacosa-2,10,12,14,25-pentaen-23-one (PubChem CID 139591095) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol. Its IUPAC name is (1R,2E,4S,5R,6S,7S,9R,10E,12E,14E,16S,17S,18S,19R,21S,24S)-5,6,7,9,19-pentahydroxy-4,14,21-trimethyl-22-azatetracyclo[14.10.0.017,24.018,22]hexacosa-2,10,12,14,25-pentaen-23-one.
| Compound Name | (1R,2E,4S,5R,6S,7S,9R,10E,12E,14E,16S,17S,18S,19R,21S,24S)-5,6,7,9,19-pentahydroxy-4,14,21-trimethyl-22-azatetracyclo[14.10.0.017,24.018,22]hexacosa-2,10,12,14,25-pentaen-23-one |
|---|---|
| PubChem CID | 139591095 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (1R,2E,4S,5R,6S,7S,9R,10E,12E,14E,16S,17S,18S,19R,21S,24S)-5,6,7,9,19-pentahydroxy-4,14,21-trimethyl-22-azatetracyclo[14.10.0.017,24.018,22]hexacosa-2,10,12,14,25-pentaen-23-one |
| SMILES | CC1=C\[C@H]2[C@@H]3[C@H]4[C@H](O)C[C@H](C)N4C(=O)[C@H]3C=C[C@H]2/C=C/[C@H](C)[C@@H](O)[C@@H](O)[C@@H](O)C[C@@H](O)/C=C\C=C\1 |
| InChI | InChI=1S/C28H39NO6/c1-15-6-4-5-7-19(30)14-23(32)27(34)26(33)16(2)8-9-18-10-11-20-24(21(18)12-15)25-22(31)13-17(3)29(25)28(20)35/h4-12,16-27,30-34H,13-14H2,1-3H3/b6-4+,7-5+,9-8+,15-12+/t16-,17-,18+,19-,20-,21+,22+,23-,24+,25+,26+,27-/m0/s1 |
| InChIKey | SNZRFPDICOBLLA-VPPVLIERSA-N |
| XLogP | 1.48 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|