C27H36O7 — CID 139591134
methyl (1S,4bS,7S,8aR,10aS)-7-acetyloxy-4b-formyl-2,3,8,8,10a-pentamethyl-1-(2-oxopropanoyl)-5,6,7,8a,9,10-hexahydrophenanthrene-1-carboxylate (PubChem CID 139591134) has the molecular formula C27H36O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is methyl (1S,4bS,7S,8aR,10aS)-7-acetyloxy-4b-formyl-2,3,8,8,10a-pentamethyl-1-(2-oxopropanoyl)-5,6,7,8a,9,10-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4bS,7S,8aR,10aS)-7-acetyloxy-4b-formyl-2,3,8,8,10a-pentamethyl-1-(2-oxopropanoyl)-5,6,7,8a,9,10-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 139591134 |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | methyl (1S,4bS,7S,8aR,10aS)-7-acetyloxy-4b-formyl-2,3,8,8,10a-pentamethyl-1-(2-oxopropanoyl)-5,6,7,8a,9,10-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C(=O)C(C)=O)C(C)=C(C)C=C2[C@]3(C=O)CC[C@H](OC(C)=O)C(C)(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H36O7/c1-15-13-20-25(7,27(16(15)2,23(32)33-8)22(31)17(3)29)11-9-19-24(5,6)21(34-18(4)30)10-12-26(19,20)14-28/h13-14,19,21H,9-12H2,1-8H3/t19-,21+,25+,26+,27+/m1/s1 |
| InChIKey | NTILUGQMUZBHBH-GZDNXMLJSA-N |
| XLogP | 3.93 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|