C15H30O9 — CID 139591154
(2R,3R,4S,6R)-6-[(2R,3R,4S,5R,6S)-3,5-dihydroxy-4,6-dimethoxy-2-methyloxan-3-yl]-6-methoxyhexane-2,3,4-triol (PubChem CID 139591154) has the molecular formula C15H30O9 and a molecular weight of 354.40 g/mol. Its IUPAC name is (2R,3R,4S,6R)-6-[(2R,3R,4S,5R,6S)-3,5-dihydroxy-4,6-dimethoxy-2-methyloxan-3-yl]-6-methoxyhexane-2,3,4-triol.
| Compound Name | (2R,3R,4S,6R)-6-[(2R,3R,4S,5R,6S)-3,5-dihydroxy-4,6-dimethoxy-2-methyloxan-3-yl]-6-methoxyhexane-2,3,4-triol |
|---|---|
| PubChem CID | 139591154 |
| Molecular Formula | C15H30O9 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2R,3R,4S,6R)-6-[(2R,3R,4S,5R,6S)-3,5-dihydroxy-4,6-dimethoxy-2-methyloxan-3-yl]-6-methoxyhexane-2,3,4-triol |
| SMILES | CO[C@H]1O[C@H](C)[C@@](O)([C@@H](C[C@H](O)[C@H](O)[C@@H](C)O)OC)[C@@H](OC)[C@H]1O |
| InChI | InChI=1S/C15H30O9/c1-7(16)11(18)9(17)6-10(21-3)15(20)8(2)24-14(23-5)12(19)13(15)22-4/h7-14,16-20H,6H2,1-5H3/t7-,8-,9+,10-,11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | AIJURRQOFYUHCO-QZPKKOLPSA-N |
| XLogP | -2.01 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |