C20H30O3 — CID 139591229
(1R,2R,6S,9R,10S,11R,14R)-11,14-bis(hydroxymethyl)-2,6,11-trimethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one (PubChem CID 139591229) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,2R,6S,9R,10S,11R,14R)-11,14-bis(hydroxymethyl)-2,6,11-trimethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one.
| Compound Name | (1R,2R,6S,9R,10S,11R,14R)-11,14-bis(hydroxymethyl)-2,6,11-trimethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one |
|---|---|
| PubChem CID | 139591229 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,2R,6S,9R,10S,11R,14R)-11,14-bis(hydroxymethyl)-2,6,11-trimethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one |
| SMILES | C[C@@H]1C=CC(=O)[C@@]2(C)CC[C@@H]3[C@H]4[C@](C)(CO)CC[C@@]4(CO)C[C@@]132 |
| InChI | InChI=1S/C20H30O3/c1-13-4-5-15(23)18(3)7-6-14-16-17(2,11-21)8-9-19(16,12-22)10-20(13,14)18/h4-5,13-14,16,21-22H,6-12H2,1-3H3/t13-,14-,16+,17+,18-,19+,20-/m1/s1 |
| InChIKey | QCCMWEYJBJLQPQ-ZIOUMKLRSA-N |
| XLogP | 2.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |