C11H16O5 — CID 139591232
(3aS,5S,5'S,6aS)-5'-(2-hydroxyethyl)spiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one (PubChem CID 139591232) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (3aS,5S,5'S,6aS)-5'-(2-hydroxyethyl)spiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one.
| Compound Name | (3aS,5S,5'S,6aS)-5'-(2-hydroxyethyl)spiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 139591232 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3aS,5S,5'S,6aS)-5'-(2-hydroxyethyl)spiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one |
| SMILES | O=C1C[C@@H]2O[C@@]3(CC[C@@H](CCO)O3)C[C@@H]2O1 |
| InChI | InChI=1S/C11H16O5/c12-4-2-7-1-3-11(15-7)6-9-8(16-11)5-10(13)14-9/h7-9,12H,1-6H2/t7-,8-,9-,11-/m0/s1 |
| InChIKey | OFTGDDQXCKMIBF-KBIXCLLPSA-N |
| XLogP | 0.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |