C25H36O4 — CID 139591235
2-[(1S,2Z,5R,6R,9S,11E,14E,16S)-2,9,12,16-tetramethyl-6-tricyclo[13.3.0.05,9]octadeca-2,11,14-trienyl]propanedioic acid (PubChem CID 139591235) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-[(1S,2Z,5R,6R,9S,11E,14E,16S)-2,9,12,16-tetramethyl-6-tricyclo[13.3.0.05,9]octadeca-2,11,14-trienyl]propanedioic acid.
| Compound Name | 2-[(1S,2Z,5R,6R,9S,11E,14E,16S)-2,9,12,16-tetramethyl-6-tricyclo[13.3.0.05,9]octadeca-2,11,14-trienyl]propanedioic acid |
|---|---|
| PubChem CID | 139591235 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-[(1S,2Z,5R,6R,9S,11E,14E,16S)-2,9,12,16-tetramethyl-6-tricyclo[13.3.0.05,9]octadeca-2,11,14-trienyl]propanedioic acid |
| SMILES | C/C1=C/C[C@@H]2[C@H](C(C(=O)O)C(=O)O)CC[C@@]2(C)C/C=C(\C)C/C=C2\[C@@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C25H36O4/c1-15-5-8-18-16(2)6-9-19(18)17(3)7-10-21-20(22(23(26)27)24(28)29)12-14-25(21,4)13-11-15/h7-8,11,16,19-22H,5-6,9-10,12-14H2,1-4H3,(H,26,27)(H,28,29)/b15-11+,17-7-,18-8-/t16-,19-,20+,21+,25+/m0/s1 |
| InChIKey | OVLRNGJHUUCIHT-ZECXTTRPSA-N |
| XLogP | 5.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|