C13H16O5 — CID 139591255
(3S,4R,5R,5aR,8aS)-4-hydroxy-5-methoxy-3-methyl-4,5,5a,7,8,8a-hexahydro-3H-pentaleno[1,2-c]pyran-1,6-dione (PubChem CID 139591255) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (3S,4R,5R,5aR,8aS)-4-hydroxy-5-methoxy-3-methyl-4,5,5a,7,8,8a-hexahydro-3H-pentaleno[1,2-c]pyran-1,6-dione.
| Compound Name | (3S,4R,5R,5aR,8aS)-4-hydroxy-5-methoxy-3-methyl-4,5,5a,7,8,8a-hexahydro-3H-pentaleno[1,2-c]pyran-1,6-dione |
|---|---|
| PubChem CID | 139591255 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (3S,4R,5R,5aR,8aS)-4-hydroxy-5-methoxy-3-methyl-4,5,5a,7,8,8a-hexahydro-3H-pentaleno[1,2-c]pyran-1,6-dione |
| SMILES | CO[C@H]1C2=C(C(=O)O[C@@H](C)[C@@H]2O)[C@H]2CCC(=O)[C@H]21 |
| InChI | InChI=1S/C13H16O5/c1-5-11(15)10-9(13(16)18-5)6-3-4-7(14)8(6)12(10)17-2/h5-6,8,11-12,15H,3-4H2,1-2H3/t5-,6-,8-,11-,12+/m0/s1 |
| InChIKey | HHAQCJVEHVPEJC-NTARPBMMSA-N |
| XLogP | 0.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |