C15H30O4 — CID 139591330
(6R)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylheptane-2,3,6-triol (PubChem CID 139591330) has the molecular formula C15H30O4 and a molecular weight of 274.40 g/mol. Its IUPAC name is (6R)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylheptane-2,3,6-triol.
| Compound Name | (6R)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylheptane-2,3,6-triol |
|---|---|
| PubChem CID | 139591330 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | (6R)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylheptane-2,3,6-triol |
| SMILES | C[C@H]1[C@H]([C@](C)(O)CCC(O)C(C)(C)O)CC[C@@]1(C)O |
| InChI | InChI=1S/C15H30O4/c1-10-11(6-8-14(10,4)18)15(5,19)9-7-12(16)13(2,3)17/h10-12,16-19H,6-9H2,1-5H3/t10-,11+,12?,14+,15+/m0/s1 |
| InChIKey | SRVFQFPFJNHMEK-IVGFHQPOSA-N |
| XLogP | 1.45 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |