About 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one
6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one (PubChem CID 139591339) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one.
Molecular Properties
| Compound Name | 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one |
| PubChem CID | 139591339 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one |
| SMILES | COc1cc(/C=C/C(O)C(C)O)oc(=O)c1 |
| InChI | InChI=1S/C11H14O5/c1-7(12)10(13)4-3-8-5-9(15-2)6-11(14)16-8/h3-7,10,12-13H,1-2H3/b4-3+ |
| InChIKey | RYVWLCXNTHEJGR-ONEGZZNKSA-N |
| XLogP | 0.40 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one?
The IUPAC name of 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one (CID 139591339) is 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one.
What is the SMILES notation for 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one?
The canonical SMILES for 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one is COc1cc(/C=C/C(O)C(C)O)oc(=O)c1.
What is the InChIKey of 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one?
The InChIKey is RYVWLCXNTHEJGR-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H14O5/c1-7(12)10(13)4-3-8-5-9(15-2)6-11(14)16-8/h3-7,10,12-13H,1-2H3/b4-3+.
What are the key properties of 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one?
6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one has a molecular weight of 226.23 g/mol, XLogP of 0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-3,4-dihydroxypent-1-enyl]-4-methoxypyran-2-one is sourced from PubChem (CID 139591339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).