C25H40 — CID 139591485
(1S,3R,6S,9S,10R,14R,17S)-3,6,14,17-tetramethyl-9-prop-1-en-2-yltetracyclo[12.3.1.03,11.06,10]octadec-11-ene (PubChem CID 139591485) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (1S,3R,6S,9S,10R,14R,17S)-3,6,14,17-tetramethyl-9-prop-1-en-2-yltetracyclo[12.3.1.03,11.06,10]octadec-11-ene.
| Compound Name | (1S,3R,6S,9S,10R,14R,17S)-3,6,14,17-tetramethyl-9-prop-1-en-2-yltetracyclo[12.3.1.03,11.06,10]octadec-11-ene |
|---|---|
| PubChem CID | 139591485 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (1S,3R,6S,9S,10R,14R,17S)-3,6,14,17-tetramethyl-9-prop-1-en-2-yltetracyclo[12.3.1.03,11.06,10]octadec-11-ene |
| SMILES | C=C(C)[C@H]1CC[C@@]2(C)CC[C@]3(C)C[C@@H]4C[C@](C)(CC=C3[C@H]12)CC[C@@H]4C |
| InChI | InChI=1S/C25H40/c1-17(2)20-8-12-24(5)13-14-25(6)16-19-15-23(4,10-7-18(19)3)11-9-21(25)22(20)24/h9,18-20,22H,1,7-8,10-16H2,2-6H3/t18-,19-,20+,22-,23-,24-,25+/m0/s1 |
| InChIKey | PKKHDWUOTCTVFH-GOIRZWFHSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|